C22H34N2O4 — CID 93152418
(3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide (PubChem CID 93152418) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93152418 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(C(=O)CC(C)C)C[C@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C22H34N2O4/c1-6-7-11-23-22(26)18-14-24(20(25)12-15(2)3)13-17(18)16-9-8-10-19(27-4)21(16)28-5/h8-10,15,17-18H,6-7,11-14H2,1-5H3,(H,23,26)/t17-,18-/m0/s1 |
| InChIKey | FMFUBEQTQTYKJM-ROUUACIJSA-N |
| XLogP | 3.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|