C21H32N2O3 — CID 42828340
4-(2-methoxyphenyl)-1-(3-methylbutanoyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide (PubChem CID 42828340) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1-(3-methylbutanoyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-(2-methoxyphenyl)-1-(3-methylbutanoyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42828340 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 4-(2-methoxyphenyl)-1-(3-methylbutanoyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1C1CN(C(=O)CC(C)C)CC1C(=O)NCC(C)C |
| InChI | InChI=1S/C21H32N2O3/c1-14(2)10-20(24)23-12-17(16-8-6-7-9-19(16)26-5)18(13-23)21(25)22-11-15(3)4/h6-9,14-15,17-18H,10-13H2,1-5H3,(H,22,25) |
| InChIKey | FNXUMMWSNRIXQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |