C21H32N2O5 — CID 42830384
4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide (PubChem CID 42830384) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42830384 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-1-(3-methylbutanoyl)pyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CN(C(=O)CC(C)C)CC1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H32N2O5/c1-14(2)10-20(24)23-12-17(18(13-23)21(25)22-8-9-26-3)16-11-15(27-4)6-7-19(16)28-5/h6-7,11,14,17-18H,8-10,12-13H2,1-5H3,(H,22,25) |
| InChIKey | QQTSXZCIZYKOMH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|