C20H31N3O3S — CID 42681425
4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide (PubChem CID 42681425) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681425 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)-N-(2-methylpropyl)pyrrolidine-3-carboxamide |
| SMILES | CCNC(=S)N1CC(C(=O)NCC(C)C)C(c2cccc(OC)c2OC)C1 |
| InChI | InChI=1S/C20H31N3O3S/c1-6-21-20(27)23-11-15(16(12-23)19(24)22-10-13(2)3)14-8-7-9-17(25-4)18(14)26-5/h7-9,13,15-16H,6,10-12H2,1-5H3,(H,21,27)(H,22,24) |
| InChIKey | GQTRNLNXPVOCSH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|