C21H31N3O3S — CID 42681444
N-(cyclopropylmethyl)-4-(2,3-dimethoxyphenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide (PubChem CID 42681444) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-(2,3-dimethoxyphenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-4-(2,3-dimethoxyphenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681444 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-(cyclopropylmethyl)-4-(2,3-dimethoxyphenyl)-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(C2CN(C(=S)NC(C)C)CC2C(=O)NCC2CC2)c1OC |
| InChI | InChI=1S/C21H31N3O3S/c1-13(2)23-21(28)24-11-16(15-6-5-7-18(26-3)19(15)27-4)17(12-24)20(25)22-10-14-8-9-14/h5-7,13-14,16-17H,8-12H2,1-4H3,(H,22,25)(H,23,28) |
| InChIKey | GSGLYGNJUKURJL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|