C20H31N3O3S — CID 93152932
(3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)pyrrolidine-3-carboxamide (PubChem CID 93152932) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93152932 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (3R,4R)-N-butyl-4-(2,3-dimethoxyphenyl)-1-(ethylcarbamothioyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CN(C(=S)NCC)C[C@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C20H31N3O3S/c1-5-7-11-22-19(24)16-13-23(20(27)21-6-2)12-15(16)14-9-8-10-17(25-3)18(14)26-4/h8-10,15-16H,5-7,11-13H2,1-4H3,(H,21,27)(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | VRCCUWKAIOYKGI-HOTGVXAUSA-N |
| XLogP | 2.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|