C24H30FN3O3S — CID 42681441
4-(2,3-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide (PubChem CID 42681441) has the molecular formula C24H30FN3O3S and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide.
| Compound Name | 4-(2,3-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681441 |
| Molecular Formula | C24H30FN3O3S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(C2CN(C(=S)NC(C)C)CC2C(=O)NCc2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C24H30FN3O3S/c1-15(2)27-24(32)28-13-19(18-6-5-7-21(30-3)22(18)31-4)20(14-28)23(29)26-12-16-8-10-17(25)11-9-16/h5-11,15,19-20H,12-14H2,1-4H3,(H,26,29)(H,27,32) |
| InChIKey | VRYVZOTXVQRMKO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|