C25H32FN3O4S — CID 93150382
(3S,4R)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 93150382) has the molecular formula C25H32FN3O4S and a molecular weight of 489.61 g/mol. Its IUPAC name is (3S,4R)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150382 |
| Molecular Formula | C25H32FN3O4S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (3S,4R)-N-[(4-fluorophenyl)methyl]-1-(propan-2-ylcarbamothioyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc([C@@H]2CN(C(=S)NC(C)C)C[C@H]2C(=O)NCc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H32FN3O4S/c1-15(2)28-25(34)29-13-19(17-10-21(31-3)23(33-5)22(11-17)32-4)20(14-29)24(30)27-12-16-6-8-18(26)9-7-16/h6-11,15,19-20H,12-14H2,1-5H3,(H,27,30)(H,28,34)/t19-,20+/m0/s1 |
| InChIKey | ANUSMUVENVKDQJ-VQTJNVASSA-N |
| XLogP | 3.47 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|