C18H27N3O2S — CID 93151943
(3S,4R)-1-(ethylcarbamothioyl)-4-(2-methoxyphenyl)-N-propylpyrrolidine-3-carboxamide (PubChem CID 93151943) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (3S,4R)-1-(ethylcarbamothioyl)-4-(2-methoxyphenyl)-N-propylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-(ethylcarbamothioyl)-4-(2-methoxyphenyl)-N-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93151943 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3S,4R)-1-(ethylcarbamothioyl)-4-(2-methoxyphenyl)-N-propylpyrrolidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CN(C(=S)NCC)C[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C18H27N3O2S/c1-4-10-20-17(22)15-12-21(18(24)19-5-2)11-14(15)13-8-6-7-9-16(13)23-3/h6-9,14-15H,4-5,10-12H2,1-3H3,(H,19,24)(H,20,22)/t14-,15+/m0/s1 |
| InChIKey | IBAINWSVAVIOAP-LSDHHAIUSA-N |
| XLogP | 2.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|