C22H35N3O4 — CID 93152869
(3S,4S)-3-N-butyl-1-N-tert-butyl-4-(2,3-dimethoxyphenyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 93152869) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is (3S,4S)-3-N-butyl-1-N-tert-butyl-4-(2,3-dimethoxyphenyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S,4S)-3-N-butyl-1-N-tert-butyl-4-(2,3-dimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93152869 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | (3S,4S)-3-N-butyl-1-N-tert-butyl-4-(2,3-dimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CN(C(=O)NC(C)(C)C)C[C@@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C22H35N3O4/c1-7-8-12-23-20(26)17-14-25(21(27)24-22(2,3)4)13-16(17)15-10-9-11-18(28-5)19(15)29-6/h9-11,16-17H,7-8,12-14H2,1-6H3,(H,23,26)(H,24,27)/t16-,17-/m1/s1 |
| InChIKey | XYCNZTAGTUUZCO-IAGOWNOFSA-N |
| XLogP | 3.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|