C21H33N3O5 — CID 93150349
(3S,4S)-3-N-butyl-1-N-ethyl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 93150349) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3S,4S)-3-N-butyl-1-N-ethyl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S,4S)-3-N-butyl-1-N-ethyl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93150349 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (3S,4S)-3-N-butyl-1-N-ethyl-4-(3,4,5-trimethoxyphenyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CN(C(=O)NCC)C[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H33N3O5/c1-6-8-9-23-20(25)16-13-24(21(26)22-7-2)12-15(16)14-10-17(27-3)19(29-5)18(11-14)28-4/h10-11,15-16H,6-9,12-13H2,1-5H3,(H,22,26)(H,23,25)/t15-,16-/m1/s1 |
| InChIKey | RPXDANPZCAEJDC-HZPDHXFCSA-N |
| XLogP | 2.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|