C24H36N2O6 — CID 97479051
(3S,4R)-1-(cyclopentanecarbonyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 97479051) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is (3S,4R)-1-(cyclopentanecarbonyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-(cyclopentanecarbonyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97479051 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (3S,4R)-1-(cyclopentanecarbonyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CN(C(=O)C2CCCC2)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H36N2O6/c1-29-11-7-10-25-23(27)19-15-26(24(28)16-8-5-6-9-16)14-18(19)17-12-20(30-2)22(32-4)21(13-17)31-3/h12-13,16,18-19H,5-11,14-15H2,1-4H3,(H,25,27)/t18-,19+/m0/s1 |
| InChIKey | ZTVCFWNDVZRSTB-RBUKOAKNSA-N |
| XLogP | 2.60 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|