C26H34N2O7 — CID 93149927
(3R,4R)-1-(3-methoxybenzoyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 93149927) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is (3R,4R)-1-(3-methoxybenzoyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-(3-methoxybenzoyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93149927 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (3R,4R)-1-(3-methoxybenzoyl)-N-(3-methoxypropyl)-4-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CN(C(=O)c2cccc(OC)c2)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H34N2O7/c1-31-11-7-10-27-25(29)21-16-28(26(30)17-8-6-9-19(12-17)32-2)15-20(21)18-13-22(33-3)24(35-5)23(14-18)34-4/h6,8-9,12-14,20-21H,7,10-11,15-16H2,1-5H3,(H,27,29)/t20-,21-/m0/s1 |
| InChIKey | LRDNUADJZYVHAK-SFTDATJTSA-N |
| XLogP | 2.73 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|