C23H27ClN2O5 — CID 93154114
(3S,4S)-1-(3-chlorobenzoyl)-4-(2,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide (PubChem CID 93154114) has the molecular formula C23H27ClN2O5 and a molecular weight of 446.93 g/mol. Its IUPAC name is (3S,4S)-1-(3-chlorobenzoyl)-4-(2,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-(3-chlorobenzoyl)-4-(2,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93154114 |
| Molecular Formula | C23H27ClN2O5 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (3S,4S)-1-(3-chlorobenzoyl)-4-(2,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CN(C(=O)c2cccc(Cl)c2)C[C@@H]1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H27ClN2O5/c1-29-10-9-25-22(27)20-14-26(23(28)15-5-4-6-16(24)11-15)13-19(20)18-8-7-17(30-2)12-21(18)31-3/h4-8,11-12,19-20H,9-10,13-14H2,1-3H3,(H,25,27)/t19-,20-/m1/s1 |
| InChIKey | QPTJONVTLUCATJ-WOJBJXKFSA-N |
| XLogP | 2.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|