C18H26FN3O2 — CID 71956269
3-N-butyl-1-N-ethyl-4-(3-fluorophenyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 71956269) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-N-butyl-1-N-ethyl-4-(3-fluorophenyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | 3-N-butyl-1-N-ethyl-4-(3-fluorophenyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71956269 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-N-butyl-1-N-ethyl-4-(3-fluorophenyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)NCC)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C18H26FN3O2/c1-3-5-9-21-17(23)16-12-22(18(24)20-4-2)11-15(16)13-7-6-8-14(19)10-13/h6-8,10,15-16H,3-5,9,11-12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | HWRNDAGNWPKRIQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|