C22H35N3O5 — CID 93154507
(3R,4R)-1-N-tert-butyl-4-(2,4-dimethoxyphenyl)-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 93154507) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3R,4R)-1-N-tert-butyl-4-(2,4-dimethoxyphenyl)-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R,4R)-1-N-tert-butyl-4-(2,4-dimethoxyphenyl)-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93154507 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (3R,4R)-1-N-tert-butyl-4-(2,4-dimethoxyphenyl)-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | COCCCNC(=O)[C@H]1CN(C(=O)NC(C)(C)C)C[C@H]1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H35N3O5/c1-22(2,3)24-21(27)25-13-17(16-9-8-15(29-5)12-19(16)30-6)18(14-25)20(26)23-10-7-11-28-4/h8-9,12,17-18H,7,10-11,13-14H2,1-6H3,(H,23,26)(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | QVLRXWZVXYSIMT-ROUUACIJSA-N |
| XLogP | 2.38 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|