C23H34N2O4 — CID 42681986
N-butyl-1-(cyclopentanecarbonyl)-4-(2,4-dimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 42681986) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-butyl-1-(cyclopentanecarbonyl)-4-(2,4-dimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-(cyclopentanecarbonyl)-4-(2,4-dimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681986 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | N-butyl-1-(cyclopentanecarbonyl)-4-(2,4-dimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)C2CCCC2)CC1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H34N2O4/c1-4-5-12-24-22(26)20-15-25(23(27)16-8-6-7-9-16)14-19(20)18-11-10-17(28-2)13-21(18)29-3/h10-11,13,16,19-20H,4-9,12,14-15H2,1-3H3,(H,24,26) |
| InChIKey | FJLXJJVXABDNCU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|