C20H31N3O5 — CID 42681845
4-(2,4-dimethoxyphenyl)-1-N-ethyl-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide (PubChem CID 42681845) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-1-N-ethyl-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-1-N-ethyl-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42681845 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-1-N-ethyl-3-N-(3-methoxypropyl)pyrrolidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)N1CC(C(=O)NCCCOC)C(c2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C20H31N3O5/c1-5-21-20(25)23-12-16(15-8-7-14(27-3)11-18(15)28-4)17(13-23)19(24)22-9-6-10-26-2/h7-8,11,16-17H,5-6,9-10,12-13H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | FLWVHEAVCUCGSF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|