C19H26FN3OS — CID 42827107
3-(4-fluorophenyl)-N-propan-2-yl-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide (PubChem CID 42827107) has the molecular formula C19H26FN3OS and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-propan-2-yl-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide.
| Compound Name | 3-(4-fluorophenyl)-N-propan-2-yl-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 42827107 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-(4-fluorophenyl)-N-propan-2-yl-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide |
| SMILES | CC(C)NC(=S)N1CC(C(=O)N2CCCC2)C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H26FN3OS/c1-13(2)21-19(25)23-11-16(14-5-7-15(20)8-6-14)17(12-23)18(24)22-9-3-4-10-22/h5-8,13,16-17H,3-4,9-12H2,1-2H3,(H,21,25) |
| InChIKey | LZJSIVRAWOTUEU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|