C21H24FN3OS — CID 93149364
(3R,4S)-1-(ethylcarbamothioyl)-N-[(4-fluorophenyl)methyl]-4-phenylpyrrolidine-3-carboxamide (PubChem CID 93149364) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is (3R,4S)-1-(ethylcarbamothioyl)-N-[(4-fluorophenyl)methyl]-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-(ethylcarbamothioyl)-N-[(4-fluorophenyl)methyl]-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93149364 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (3R,4S)-1-(ethylcarbamothioyl)-N-[(4-fluorophenyl)methyl]-4-phenylpyrrolidine-3-carboxamide |
| SMILES | CCNC(=S)N1C[C@H](C(=O)NCc2ccc(F)cc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H24FN3OS/c1-2-23-21(27)25-13-18(16-6-4-3-5-7-16)19(14-25)20(26)24-12-15-8-10-17(22)11-9-15/h3-11,18-19H,2,12-14H2,1H3,(H,23,27)(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | MSQMUBCBRAGNBO-MOPGFXCFSA-N |
| XLogP | 3.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|