C25H30N2O6 — CID 42680840
1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(2,5-dimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 42680840) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(2,5-dimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(2,5-dimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42680840 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-N-butyl-4-(2,5-dimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CN(C(=O)c2ccc3c(c2)OCO3)CC1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H30N2O6/c1-4-5-10-26-24(28)20-14-27(25(29)16-6-8-22-23(11-16)33-15-32-22)13-19(20)18-12-17(30-2)7-9-21(18)31-3/h6-9,11-12,19-20H,4-5,10,13-15H2,1-3H3,(H,26,28) |
| InChIKey | MXNQREVKJAGQDV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|