C23H28N2O3 — CID 93152687
(3S,4R)-N-(2-methoxyethyl)-1-(2-methylbenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide (PubChem CID 93152687) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (3S,4R)-N-(2-methoxyethyl)-1-(2-methylbenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-(2-methoxyethyl)-1-(2-methylbenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93152687 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (3S,4R)-N-(2-methoxyethyl)-1-(2-methylbenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CN(C(=O)c2ccccc2C)C[C@H]1c1ccccc1C |
| InChI | InChI=1S/C23H28N2O3/c1-16-8-4-6-10-18(16)20-14-25(15-21(20)22(26)24-12-13-28-3)23(27)19-11-7-5-9-17(19)2/h4-11,20-21H,12-15H2,1-3H3,(H,24,26)/t20-,21+/m0/s1 |
| InChIKey | UAOSHNYUOCJKPB-LEWJYISDSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|