C26H25FN2O2 — CID 42681083
N-benzyl-1-(2-fluorobenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide (PubChem CID 42681083) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-benzyl-1-(2-fluorobenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-benzyl-1-(2-fluorobenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681083 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-benzyl-1-(2-fluorobenzoyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1ccccc1C1CN(C(=O)c2ccccc2F)CC1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H25FN2O2/c1-18-9-5-6-12-20(18)22-16-29(26(31)21-13-7-8-14-24(21)27)17-23(22)25(30)28-15-19-10-3-2-4-11-19/h2-14,22-23H,15-17H2,1H3,(H,28,30) |
| InChIKey | OSSAGYHSOIYEAJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |