C27H28N2O3 — CID 93150878
(3R,4R)-N-benzyl-4-(3-methoxyphenyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide (PubChem CID 93150878) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-4-(3-methoxyphenyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-benzyl-4-(3-methoxyphenyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150878 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3R,4R)-N-benzyl-4-(3-methoxyphenyl)-1-(2-methylbenzoyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cccc([C@@H]2CN(C(=O)c3ccccc3C)C[C@@H]2C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-19-9-6-7-14-23(19)27(31)29-17-24(21-12-8-13-22(15-21)32-2)25(18-29)26(30)28-16-20-10-4-3-5-11-20/h3-15,24-25H,16-18H2,1-2H3,(H,28,30)/t24-,25-/m0/s1 |
| InChIKey | CDSVYKVSHISWNH-DQEYMECFSA-N |
| XLogP | 4.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |