C21H26N2O4S — CID 42681490
1-(benzenesulfonyl)-N-(2-methoxyethyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide (PubChem CID 42681490) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2-methoxyethyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(2-methoxyethyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42681490 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2-methoxyethyl)-4-(2-methylphenyl)pyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CN(S(=O)(=O)c2ccccc2)CC1c1ccccc1C |
| InChI | InChI=1S/C21H26N2O4S/c1-16-8-6-7-11-18(16)19-14-23(15-20(19)21(24)22-12-13-27-2)28(25,26)17-9-4-3-5-10-17/h3-11,19-20H,12-15H2,1-2H3,(H,22,24) |
| InChIKey | KSCHBTKNHTUXQY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|