C22H24ClF3N2O4S — CID 93149402
(3R,4S)-1-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 93149402) has the molecular formula C22H24ClF3N2O4S and a molecular weight of 504.96 g/mol. Its IUPAC name is (3R,4S)-1-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93149402 |
| Molecular Formula | C22H24ClF3N2O4S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (3R,4S)-1-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CN(S(=O)(=O)c2ccc(Cl)cc2)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24ClF3N2O4S/c1-32-11-3-10-27-21(29)20-14-28(33(30,31)18-8-6-17(23)7-9-18)13-19(20)15-4-2-5-16(12-15)22(24,25)26/h2,4-9,12,19-20H,3,10-11,13-14H2,1H3,(H,27,29)/t19-,20+/m1/s1 |
| InChIKey | SYFREJFHAUHMIQ-UXHICEINSA-N |
| XLogP | 3.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|