C19H25Cl2N3O2S — CID 120947840
6-(1,3-benzothiazol-2-yl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide;dihydrochloride (PubChem CID 120947840) has the molecular formula C19H25Cl2N3O2S and a molecular weight of 430.40 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide;dihydrochloride.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120947840 |
| Molecular Formula | C19H25Cl2N3O2S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1CNCC1O)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H23N3O2S.2ClH/c23-16-11-20-9-12(16)10-21-18(24)13-5-1-2-6-14(13)19-22-15-7-3-4-8-17(15)25-19;;/h1-4,7-8,12-14,16,20,23H,5-6,9-11H2,(H,21,24);2*1H |
| InChIKey | HWHRDHAIUYYEFX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|