C25H28N2O2S — CID 55599479
6-(1,3-benzothiazol-2-yl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 55599479) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 55599479 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC(C)OCc1ccccc1CNC(=O)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H28N2O2S/c1-17(2)29-16-19-10-4-3-9-18(19)15-26-24(28)20-11-5-6-12-21(20)25-27-22-13-7-8-14-23(22)30-25/h3-10,13-14,17,20-21H,11-12,15-16H2,1-2H3,(H,26,28) |
| InChIKey | PCBWYMXILLGMPW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|