C16H15F3N2OS — CID 51934202
(1R,6S)-6-(1,3-benzothiazol-2-yl)-N-(2,2,2-trifluoroethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 51934202) has the molecular formula C16H15F3N2OS and a molecular weight of 340.37 g/mol. Its IUPAC name is (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-(2,2,2-trifluoroethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-(2,2,2-trifluoroethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51934202 |
| Molecular Formula | C16H15F3N2OS |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-(2,2,2-trifluoroethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1CC=CC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H15F3N2OS/c17-16(18,19)9-20-14(22)10-5-1-2-6-11(10)15-21-12-7-3-4-8-13(12)23-15/h1-4,7-8,10-11H,5-6,9H2,(H,20,22)/t10-,11+/m1/s1 |
| InChIKey | VVUIEJHCCXJBGX-MNOVXSKESA-N |
| XLogP | 4.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|