C22H20BrN3O2S — CID 55993204
6-(1,3-benzothiazol-2-yl)-N-[2-(4-bromoanilino)-2-oxoethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 55993204) has the molecular formula C22H20BrN3O2S and a molecular weight of 470.39 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[2-(4-bromoanilino)-2-oxoethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[2-(4-bromoanilino)-2-oxoethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 55993204 |
| Molecular Formula | C22H20BrN3O2S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[2-(4-bromoanilino)-2-oxoethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(CNC(=O)C1CC=CCC1c1nc2ccccc2s1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrN3O2S/c23-14-9-11-15(12-10-14)25-20(27)13-24-21(28)16-5-1-2-6-17(16)22-26-18-7-3-4-8-19(18)29-22/h1-4,7-12,16-17H,5-6,13H2,(H,24,28)(H,25,27) |
| InChIKey | ZMSDRFKAKOGIMJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|