C22H22N2OS2 — CID 51934155
(1S,6R)-6-(1,3-benzothiazol-2-yl)-N-(2-phenylsulfanylethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 51934155) has the molecular formula C22H22N2OS2 and a molecular weight of 394.57 g/mol. Its IUPAC name is (1S,6R)-6-(1,3-benzothiazol-2-yl)-N-(2-phenylsulfanylethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6R)-6-(1,3-benzothiazol-2-yl)-N-(2-phenylsulfanylethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51934155 |
| Molecular Formula | C22H22N2OS2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (1S,6R)-6-(1,3-benzothiazol-2-yl)-N-(2-phenylsulfanylethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)[C@H]1CC=CC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H22N2OS2/c25-21(23-14-15-26-16-8-2-1-3-9-16)17-10-4-5-11-18(17)22-24-19-12-6-7-13-20(19)27-22/h1-9,12-13,17-18H,10-11,14-15H2,(H,23,25)/t17-,18+/m0/s1 |
| InChIKey | TVKLHLJATLTOPH-ZWKOTPCHSA-N |
| XLogP | 5.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|