C16H18N2OS — CID 47323856
6-(1,3-benzothiazol-2-yl)-N-ethylcyclohex-3-ene-1-carboxamide (PubChem CID 47323856) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-ethylcyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-ethylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 47323856 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-ethylcyclohex-3-ene-1-carboxamide |
| SMILES | CCNC(=O)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H18N2OS/c1-2-17-15(19)11-7-3-4-8-12(11)16-18-13-9-5-6-10-14(13)20-16/h3-6,9-12H,2,7-8H2,1H3,(H,17,19) |
| InChIKey | OSCFBHZZANUBFD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|