C22H23N3O3S2 — CID 93278386
(1R,6R)-6-(1,3-benzothiazol-2-yl)-N-[[3-(methanesulfonamido)phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 93278386) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (1R,6R)-6-(1,3-benzothiazol-2-yl)-N-[[3-(methanesulfonamido)phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-(1,3-benzothiazol-2-yl)-N-[[3-(methanesulfonamido)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 93278386 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (1R,6R)-6-(1,3-benzothiazol-2-yl)-N-[[3-(methanesulfonamido)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(CNC(=O)[C@@H]2CC=CC[C@H]2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H23N3O3S2/c1-30(27,28)25-16-8-6-7-15(13-16)14-23-21(26)17-9-2-3-10-18(17)22-24-19-11-4-5-12-20(19)29-22/h2-8,11-13,17-18,25H,9-10,14H2,1H3,(H,23,26)/t17-,18-/m1/s1 |
| InChIKey | BMFDHFYXECIVSG-QZTJIDSGSA-N |
| XLogP | 4.03 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|