C20H18FN3OS — CID 75460732
6-(1,3-benzothiazol-2-yl)-N'-(4-fluorophenyl)cyclohex-3-ene-1-carbohydrazide (PubChem CID 75460732) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N'-(4-fluorophenyl)cyclohex-3-ene-1-carbohydrazide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N'-(4-fluorophenyl)cyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 75460732 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N'-(4-fluorophenyl)cyclohex-3-ene-1-carbohydrazide |
| SMILES | O=C(NNc1ccc(F)cc1)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18FN3OS/c21-13-9-11-14(12-10-13)23-24-19(25)15-5-1-2-6-16(15)20-22-17-7-3-4-8-18(17)26-20/h1-4,7-12,15-16,23H,5-6H2,(H,24,25) |
| InChIKey | SXRINNVTUHFAOS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|