C21H18FN3O2S — CID 55565632
N'-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-4-fluorobenzohydrazide (PubChem CID 55565632) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is N'-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 55565632 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N'-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-4-fluorobenzohydrazide |
| SMILES | O=C(NNC(=O)C1CC=CCC1c1nc2ccccc2s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FN3O2S/c22-14-11-9-13(10-12-14)19(26)24-25-20(27)15-5-1-2-6-16(15)21-23-17-7-3-4-8-18(17)28-21/h1-4,7-12,15-16H,5-6H2,(H,24,26)(H,25,27) |
| InChIKey | NOJMIBJPGGZDCJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|