C19H21N3O2S — CID 98787034
(1S,6S)-6-(1,3-benzothiazol-2-yl)-N-[(3S)-2-oxopiperidin-3-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 98787034) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is (1S,6S)-6-(1,3-benzothiazol-2-yl)-N-[(3S)-2-oxopiperidin-3-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-6-(1,3-benzothiazol-2-yl)-N-[(3S)-2-oxopiperidin-3-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 98787034 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1S,6S)-6-(1,3-benzothiazol-2-yl)-N-[(3S)-2-oxopiperidin-3-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C1NCCC[C@@H]1NC(=O)[C@H]1CC=CC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H21N3O2S/c23-17(21-15-9-5-11-20-18(15)24)12-6-1-2-7-13(12)19-22-14-8-3-4-10-16(14)25-19/h1-4,8,10,12-13,15H,5-7,9,11H2,(H,20,24)(H,21,23)/t12-,13-,15-/m0/s1 |
| InChIKey | WVZFCFOQGOGIPQ-YDHLFZDLSA-N |
| XLogP | 2.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|