C23H22N2O3S — CID 55962248
6-(1,3-benzothiazol-2-yl)-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 55962248) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 55962248 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC1(C)Oc2ccc(NC(=O)C3CC=CCC3c3nc4ccccc4s3)cc2O1 |
| InChI | InChI=1S/C23H22N2O3S/c1-23(2)27-18-12-11-14(13-19(18)28-23)24-21(26)15-7-3-4-8-16(15)22-25-17-9-5-6-10-20(17)29-22/h3-6,9-13,15-16H,7-8H2,1-2H3,(H,24,26) |
| InChIKey | XUMLAHXDVISXGF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|