C23H21N5OS — CID 78865336
6-(1,3-benzothiazol-2-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 78865336) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 78865336 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cn2cncn2)cc1)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H21N5OS/c29-22(26-17-11-9-16(10-12-17)13-28-15-24-14-25-28)18-5-1-2-6-19(18)23-27-20-7-3-4-8-21(20)30-23/h1-4,7-12,14-15,18-19H,5-6,13H2,(H,26,29) |
| InChIKey | YMVGSLZJLVBQQX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|