C24H25FN2O2S — CID 95782205
(1R,6S)-6-(1,3-benzothiazol-2-yl)-N-[(2R)-2-[(2-fluorophenyl)methyl]-3-hydroxypropyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95782205) has the molecular formula C24H25FN2O2S and a molecular weight of 424.54 g/mol. Its IUPAC name is (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-[(2R)-2-[(2-fluorophenyl)methyl]-3-hydroxypropyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-[(2R)-2-[(2-fluorophenyl)methyl]-3-hydroxypropyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95782205 |
| Molecular Formula | C24H25FN2O2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (1R,6S)-6-(1,3-benzothiazol-2-yl)-N-[(2R)-2-[(2-fluorophenyl)methyl]-3-hydroxypropyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@H](CO)Cc1ccccc1F)[C@@H]1CC=CC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H25FN2O2S/c25-20-10-4-1-7-17(20)13-16(15-28)14-26-23(29)18-8-2-3-9-19(18)24-27-21-11-5-6-12-22(21)30-24/h1-7,10-12,16,18-19,28H,8-9,13-15H2,(H,26,29)/t16-,18-,19+/m1/s1 |
| InChIKey | XDDKAAIMISTTAF-QRQLOZEOSA-N |
| XLogP | 4.45 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|