C22H24N2O3S — CID 119175596
6-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119175596) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 6-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119175596 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6-[6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC12CCN(C(=O)C1CC=CCC1c1nc3ccccc3s1)CC2 |
| InChI | InChI=1S/C22H24N2O3S/c25-20(24-11-9-22(10-12-24)13-16(22)21(26)27)15-6-2-1-5-14(15)19-23-17-7-3-4-8-18(17)28-19/h1-4,7-8,14-16H,5-6,9-13H2,(H,26,27) |
| InChIKey | RQSNFYJLNCWPFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|