About 2-aminobenzenethiol;hydrofluoride
2-aminobenzenethiol;hydrofluoride (PubChem CID 175609011) has the molecular formula C6H8FNS
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-aminobenzenethiol;hydrofluoride.
Molecular Properties
| Compound Name | 2-aminobenzenethiol;hydrofluoride |
| PubChem CID | 175609011 |
| Molecular Formula | C6H8FNS |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 2-aminobenzenethiol;hydrofluoride |
| SMILES | F.Nc1ccccc1S |
| InChI | InChI=1S/C6H7NS.FH/c7-5-3-1-2-4-6(5)8;/h1-4,8H,7H2;1H |
| InChIKey | IZLOKKJTGHGJLX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenethiol;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenethiol;hydrofluoride?
The IUPAC name of 2-aminobenzenethiol;hydrofluoride (CID 175609011) is 2-aminobenzenethiol;hydrofluoride.
What is the SMILES notation for 2-aminobenzenethiol;hydrofluoride?
The canonical SMILES for 2-aminobenzenethiol;hydrofluoride is F.Nc1ccccc1S.
What is the InChIKey of 2-aminobenzenethiol;hydrofluoride?
The InChIKey is IZLOKKJTGHGJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS.FH/c7-5-3-1-2-4-6(5)8;/h1-4,8H,7H2;1H.
What are the key properties of 2-aminobenzenethiol;hydrofluoride?
2-aminobenzenethiol;hydrofluoride has a molecular weight of 145.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenethiol;hydrofluoride is sourced from PubChem (CID 175609011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).