C12H15N3O4S — CID 86760076
(2S)-2-aminopentanedioic acid;1,3-benzothiazol-2-amine (PubChem CID 86760076) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;1,3-benzothiazol-2-amine.
| Compound Name | (2S)-2-aminopentanedioic acid;1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 86760076 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;1,3-benzothiazol-2-amine |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H6N2S.C5H9NO4/c8-7-9-5-3-1-2-4-6(5)10-7;6-3(5(9)10)1-2-4(7)8/h1-4H,(H2,8,9);3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| InChIKey | VYUUCNNLBBCKIY-HVDRVSQOSA-N |
| XLogP | 1.14 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |