C18H17N3O3S — CID 131973516
2-amino-5-[2-(1,3-benzothiazol-2-yl)anilino]-5-oxopentanoic acid (PubChem CID 131973516) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-amino-5-[2-(1,3-benzothiazol-2-yl)anilino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[2-(1,3-benzothiazol-2-yl)anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 131973516 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-amino-5-[2-(1,3-benzothiazol-2-yl)anilino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)Nc1ccccc1-c1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C18H17N3O3S/c19-12(18(23)24)9-10-16(22)20-13-6-2-1-5-11(13)17-21-14-7-3-4-8-15(14)25-17/h1-8,12H,9-10,19H2,(H,20,22)(H,23,24) |
| InChIKey | UIBUUHBDTFWLBI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |