C21H17N3O2S2 — CID 55368191
N-[3-[2-(1,3-benzothiazol-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 55368191) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[3-[2-(1,3-benzothiazol-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-(1,3-benzothiazol-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55368191 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[3-[2-(1,3-benzothiazol-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1cccs1)Nc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H17N3O2S2/c25-19(11-12-22-20(26)18-10-5-13-27-18)23-15-7-2-1-6-14(15)21-24-16-8-3-4-9-17(16)28-21/h1-10,13H,11-12H2,(H,22,26)(H,23,25) |
| InChIKey | HFELOQXXCYNUBJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |