C16H15N3O2S2 — CID 30370193
N-[3-(thiophene-2-carbonylamino)propyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 30370193) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[3-(thiophene-2-carbonylamino)propyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[3-(thiophene-2-carbonylamino)propyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 30370193 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[3-(thiophene-2-carbonylamino)propyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1nc2ccccc2s1)c1cccs1 |
| InChI | InChI=1S/C16H15N3O2S2/c20-14(13-7-3-10-22-13)17-8-4-9-18-15(21)16-19-11-5-1-2-6-12(11)23-16/h1-3,5-7,10H,4,8-9H2,(H,17,20)(H,18,21) |
| InChIKey | SGJXVRRGNSBAEO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|