C15H13N5O2S — CID 30370261
N-[2-(pyrazine-2-carbonylamino)ethyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 30370261) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is N-[2-(pyrazine-2-carbonylamino)ethyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-(pyrazine-2-carbonylamino)ethyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 30370261 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[2-(pyrazine-2-carbonylamino)ethyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc2ccccc2s1)c1cnccn1 |
| InChI | InChI=1S/C15H13N5O2S/c21-13(11-9-16-5-6-17-11)18-7-8-19-14(22)15-20-10-3-1-2-4-12(10)23-15/h1-6,9H,7-8H2,(H,18,21)(H,19,22) |
| InChIKey | FDYKJEFFIIKMMA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|