C19H17N7OS — CID 122314294
N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 122314294) has the molecular formula C19H17N7OS and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 122314294 |
| Molecular Formula | C19H17N7OS |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NCCNc1cc(Nc2ccccn2)ncn1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17N7OS/c27-18(19-25-13-5-1-2-6-14(13)28-19)22-10-9-21-16-11-17(24-12-23-16)26-15-7-3-4-8-20-15/h1-8,11-12H,9-10H2,(H,22,27)(H2,20,21,23,24,26) |
| InChIKey | ANPAFSOBRKEGAX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|