C15H20N6O — CID 122314104
N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]butanamide (PubChem CID 122314104) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]butanamide.
| Compound Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 122314104 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]butanamide |
| SMILES | CCCC(=O)NCCNc1cc(Nc2ccccn2)ncn1 |
| InChI | InChI=1S/C15H20N6O/c1-2-5-15(22)18-9-8-17-13-10-14(20-11-19-13)21-12-6-3-4-7-16-12/h3-4,6-7,10-11H,2,5,8-9H2,1H3,(H,18,22)(H2,16,17,19,20,21) |
| InChIKey | JOZIZCNTWXQRJH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|