C21H22N6O — CID 122314391
(E)-3-(2-methylphenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 122314391) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is (E)-3-(2-methylphenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methylphenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122314391 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (E)-3-(2-methylphenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | Cc1ccccc1/C=C/C(=O)NCCNc1cc(Nc2ccccn2)ncn1 |
| InChI | InChI=1S/C21H22N6O/c1-16-6-2-3-7-17(16)9-10-21(28)24-13-12-23-19-14-20(26-15-25-19)27-18-8-4-5-11-22-18/h2-11,14-15H,12-13H2,1H3,(H,24,28)(H2,22,23,25,26,27)/b10-9+ |
| InChIKey | ZXCNQGWDGFEAAO-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|