C14H13N5OS — CID 47027909
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]pyrazine-2-carboxamide (PubChem CID 47027909) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47027909 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCNc1nc2ccccc2s1)c1cnccn1 |
| InChI | InChI=1S/C14H13N5OS/c20-13(11-9-15-5-6-16-11)17-7-8-18-14-19-10-3-1-2-4-12(10)21-14/h1-6,9H,7-8H2,(H,17,20)(H,18,19) |
| InChIKey | FWRULHKFCRZCRH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|